C25H22Cl2N2O2 — CID 170492308
9H-fluoren-9-ylmethyl N-[4-(4-amino-3,5-dichlorophenyl)but-3-enyl]carbamate (PubChem CID 170492308) has the molecular formula C25H22Cl2N2O2 and a molecular weight of 453.37 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(4-amino-3,5-dichlorophenyl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(4-amino-3,5-dichlorophenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492308 |
| Molecular Formula | C25H22Cl2N2O2 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(4-amino-3,5-dichlorophenyl)but-3-enyl]carbamate |
| SMILES | Nc1c(Cl)cc(C=CCCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1Cl |
| InChI | InChI=1S/C25H22Cl2N2O2/c26-22-13-16(14-23(27)24(22)28)7-5-6-12-29-25(30)31-15-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-5,7-11,13-14,21H,6,12,15,28H2,(H,29,30) |
| InChIKey | IRBFSBPMLJHRFC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|