C25H25N3O3 — CID 170492225
9H-fluoren-9-ylmethyl N-[4-(5-amino-6-methoxy-3-pyridinyl)but-3-enyl]carbamate (PubChem CID 170492225) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(5-amino-6-methoxy-3-pyridinyl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(5-amino-6-methoxy-3-pyridinyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492225 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(5-amino-6-methoxy-3-pyridinyl)but-3-enyl]carbamate |
| SMILES | COc1ncc(C=CCCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1N |
| InChI | InChI=1S/C25H25N3O3/c1-30-24-23(26)14-17(15-28-24)8-6-7-13-27-25(29)31-16-22-20-11-4-2-9-18(20)19-10-3-5-12-21(19)22/h2-6,8-12,14-15,22H,7,13,16,26H2,1H3,(H,27,29) |
| InChIKey | RFIJDIYTKDXKNH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|