C27H27NO3 — CID 170492162
9H-fluoren-9-ylmethyl N-[4-(4-hydroxy-3,5-dimethylphenyl)but-3-enyl]carbamate (PubChem CID 170492162) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(4-hydroxy-3,5-dimethylphenyl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(4-hydroxy-3,5-dimethylphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492162 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(4-hydroxy-3,5-dimethylphenyl)but-3-enyl]carbamate |
| SMILES | Cc1cc(C=CCCNC(=O)OCC2c3ccccc3-c3ccccc32)cc(C)c1O |
| InChI | InChI=1S/C27H27NO3/c1-18-15-20(16-19(2)26(18)29)9-7-8-14-28-27(30)31-17-25-23-12-5-3-10-21(23)22-11-4-6-13-24(22)25/h3-7,9-13,15-16,25,29H,8,14,17H2,1-2H3,(H,28,30) |
| InChIKey | FARNNZMMJZLGAH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|