C26H24N2O2S — CID 170492239
9H-fluoren-9-ylmethyl N-[4-(3-carbamothioylphenyl)but-3-enyl]carbamate (PubChem CID 170492239) has the molecular formula C26H24N2O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(3-carbamothioylphenyl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(3-carbamothioylphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492239 |
| Molecular Formula | C26H24N2O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(3-carbamothioylphenyl)but-3-enyl]carbamate |
| SMILES | NC(=S)c1cccc(C=CCCNC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C26H24N2O2S/c27-25(31)19-10-7-9-18(16-19)8-5-6-15-28-26(29)30-17-24-22-13-3-1-11-20(22)21-12-2-4-14-23(21)24/h1-5,7-14,16,24H,6,15,17H2,(H2,27,31)(H,28,29) |
| InChIKey | JMGQURZUSWMREX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|