C29H27NO4 — CID 170493030
1-[3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]phenyl]cyclopropane-1-carboxylic acid (PubChem CID 170493030) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 1-[3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 170493030 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1-[3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]phenyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(NCCC=Cc1cccc(C2(C(=O)O)CC2)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H27NO4/c31-27(32)29(15-16-29)21-10-7-9-20(18-21)8-5-6-17-30-28(33)34-19-26-24-13-3-1-11-22(24)23-12-2-4-14-25(23)26/h1-5,7-14,18,26H,6,15-17,19H2,(H,30,33)(H,31,32) |
| InChIKey | WBPLJUHPGQZUNE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|