C27H25NO5 — CID 170492824
methyl 5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-2-hydroxybenzoate (PubChem CID 170492824) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is methyl 5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-2-hydroxybenzoate.
| Compound Name | methyl 5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 170492824 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | methyl 5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(C=CCCNC(=O)OCC2c3ccccc3-c3ccccc32)ccc1O |
| InChI | InChI=1S/C27H25NO5/c1-32-26(30)23-16-18(13-14-25(23)29)8-6-7-15-28-27(31)33-17-24-21-11-4-2-9-19(21)20-10-3-5-12-22(20)24/h2-6,8-14,16,24,29H,7,15,17H2,1H3,(H,28,31) |
| InChIKey | WOSCLLQBOCTPLK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|