C26H24ClNO3 — CID 170492122
9H-fluoren-9-ylmethyl N-[4-(4-chloro-3-methoxyphenyl)but-3-enyl]carbamate (PubChem CID 170492122) has the molecular formula C26H24ClNO3 and a molecular weight of 433.94 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(4-chloro-3-methoxyphenyl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(4-chloro-3-methoxyphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492122 |
| Molecular Formula | C26H24ClNO3 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(4-chloro-3-methoxyphenyl)but-3-enyl]carbamate |
| SMILES | COc1cc(C=CCCNC(=O)OCC2c3ccccc3-c3ccccc32)ccc1Cl |
| InChI | InChI=1S/C26H24ClNO3/c1-30-25-16-18(13-14-24(25)27)8-6-7-15-28-26(29)31-17-23-21-11-4-2-9-19(21)20-10-3-5-12-22(20)23/h2-6,8-14,16,23H,7,15,17H2,1H3,(H,28,29) |
| InChIKey | FRNXJYZHINXRJS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|