C26H26N2O3 — CID 170492355
9H-fluoren-9-ylmethyl N-[4-(4-amino-2-methoxyphenyl)but-3-enyl]carbamate (PubChem CID 170492355) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(4-amino-2-methoxyphenyl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(4-amino-2-methoxyphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492355 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(4-amino-2-methoxyphenyl)but-3-enyl]carbamate |
| SMILES | COc1cc(N)ccc1C=CCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H26N2O3/c1-30-25-16-19(27)14-13-18(25)8-6-7-15-28-26(29)31-17-24-22-11-4-2-9-20(22)21-10-3-5-12-23(21)24/h2-6,8-14,16,24H,7,15,17,27H2,1H3,(H,28,29) |
| InChIKey | FIPSXYMGNQFOQO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|