C28H29NO4 — CID 170492785
9H-fluoren-9-ylmethyl N-[4-[2-(dimethoxymethyl)phenyl]but-3-enyl]carbamate (PubChem CID 170492785) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[2-(dimethoxymethyl)phenyl]but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[2-(dimethoxymethyl)phenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492785 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[2-(dimethoxymethyl)phenyl]but-3-enyl]carbamate |
| SMILES | COC(OC)c1ccccc1C=CCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H29NO4/c1-31-27(32-2)21-13-4-3-11-20(21)12-9-10-18-29-28(30)33-19-26-24-16-7-5-14-22(24)23-15-6-8-17-25(23)26/h3-9,11-17,26-27H,10,18-19H2,1-2H3,(H,29,30) |
| InChIKey | DMXITEDUWHVYAQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|