C25H25N3O2 — CID 170491888
9H-fluoren-9-ylmethyl N-[4-(2,3-diaminophenyl)but-3-enyl]carbamate (PubChem CID 170491888) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2,3-diaminophenyl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2,3-diaminophenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170491888 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2,3-diaminophenyl)but-3-enyl]carbamate |
| SMILES | Nc1cccc(C=CCCNC(=O)OCC2c3ccccc3-c3ccccc32)c1N |
| InChI | InChI=1S/C25H25N3O2/c26-23-14-7-9-17(24(23)27)8-5-6-15-28-25(29)30-16-22-20-12-3-1-10-18(20)19-11-2-4-13-21(19)22/h1-5,7-14,22H,6,15-16,26-27H2,(H,28,29) |
| InChIKey | VFGNSIVNLWUYAJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|