C25H22N2O5 — CID 170492724
9H-fluoren-9-ylmethyl N-[4-(3-hydroxy-4-nitrophenyl)but-3-enyl]carbamate (PubChem CID 170492724) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(3-hydroxy-4-nitrophenyl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(3-hydroxy-4-nitrophenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492724 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(3-hydroxy-4-nitrophenyl)but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1ccc([N+](=O)[O-])c(O)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H22N2O5/c28-24-15-17(12-13-23(24)27(30)31)7-5-6-14-26-25(29)32-16-22-20-10-3-1-8-18(20)19-9-2-4-11-21(19)22/h1-5,7-13,15,22,28H,6,14,16H2,(H,26,29) |
| InChIKey | IDQAEQWVSALKDU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|