C23H21N3O3 — CID 170493281
9H-fluoren-9-ylmethyl N-[4-(2-oxo-1H-pyrimidin-5-yl)but-3-enyl]carbamate (PubChem CID 170493281) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-oxo-1H-pyrimidin-5-yl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-oxo-1H-pyrimidin-5-yl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170493281 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-oxo-1H-pyrimidin-5-yl)but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1cnc(=O)[nH]c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H21N3O3/c27-22-25-13-16(14-26-22)7-5-6-12-24-23(28)29-15-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-5,7-11,13-14,21H,6,12,15H2,(H,24,28)(H,25,26,27) |
| InChIKey | DYPAHDAWBWMFEE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|