C13H13BrO — CID 145470341
1-bromo-3-[(2E)-2-ethenylpenta-2,4-dienoxy]benzene (PubChem CID 145470341) has the molecular formula C13H13BrO and a molecular weight of 265.15 g/mol. Its IUPAC name is 1-bromo-3-[(2E)-2-ethenylpenta-2,4-dienoxy]benzene.
| Compound Name | 1-bromo-3-[(2E)-2-ethenylpenta-2,4-dienoxy]benzene |
|---|---|
| PubChem CID | 145470341 |
| Molecular Formula | C13H13BrO |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 1-bromo-3-[(2E)-2-ethenylpenta-2,4-dienoxy]benzene |
| SMILES | C=C/C=C(\C=C)COc1cccc(Br)c1 |
| InChI | InChI=1S/C13H13BrO/c1-3-6-11(4-2)10-15-13-8-5-7-12(14)9-13/h3-9H,1-2,10H2/b11-6+ |
| InChIKey | CDWNIZIVDNBTGE-IZZDOVSWSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|