C13H24O2 — CID 154661218
ethane;(3E)-3-(2-ethoxyethoxymethyl)hexa-1,3,5-triene (PubChem CID 154661218) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is ethane;(3E)-3-(2-ethoxyethoxymethyl)hexa-1,3,5-triene.
| Compound Name | ethane;(3E)-3-(2-ethoxyethoxymethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 154661218 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | ethane;(3E)-3-(2-ethoxyethoxymethyl)hexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C)COCCOCC.CC |
| InChI | InChI=1S/C11H18O2.C2H6/c1-4-7-11(5-2)10-13-9-8-12-6-3;1-2/h4-5,7H,1-2,6,8-10H2,3H3;1-2H3/b11-7+; |
| InChIKey | AAQOCMPNMYZAAD-RVDQCCQOSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|