C9H14O — CID 87413665
(3E)-3-(ethoxymethyl)hexa-1,3,5-triene (PubChem CID 87413665) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (3E)-3-(ethoxymethyl)hexa-1,3,5-triene.
| Compound Name | (3E)-3-(ethoxymethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 87413665 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (3E)-3-(ethoxymethyl)hexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C)COCC |
| InChI | InChI=1S/C9H14O/c1-4-7-9(5-2)8-10-6-3/h4-5,7H,1-2,6,8H2,3H3/b9-7+ |
| InChIKey | CQFDUCKMXPMOKU-VQHVLOKHSA-N |
| XLogP | 2.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|