C17H32 — CID 143653088
ethane;(3Z,5Z)-6-ethenyl-4-ethylnona-1,3,5-triene (PubChem CID 143653088) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is ethane;(3Z,5Z)-6-ethenyl-4-ethylnona-1,3,5-triene.
| Compound Name | ethane;(3Z,5Z)-6-ethenyl-4-ethylnona-1,3,5-triene |
|---|---|
| PubChem CID | 143653088 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | ethane;(3Z,5Z)-6-ethenyl-4-ethylnona-1,3,5-triene |
| SMILES | C=C/C=C(\C=C(/C=C)CCC)CC.CC.CC |
| InChI | InChI=1S/C13H20.2C2H6/c1-5-9-12(7-3)11-13(8-4)10-6-2;2*1-2/h5,8-9,11H,1,4,6-7,10H2,2-3H3;2*1-2H3/b12-9-,13-11+;; |
| InChIKey | UITFMMNHJFGAKH-SBOVCRHPSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|