C10H13N — CID 143284376
(2E,4Z)-4-ethyl-2-methylhepta-2,4,6-trienenitrile (PubChem CID 143284376) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is (2E,4Z)-4-ethyl-2-methylhepta-2,4,6-trienenitrile.
| Compound Name | (2E,4Z)-4-ethyl-2-methylhepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 143284376 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (2E,4Z)-4-ethyl-2-methylhepta-2,4,6-trienenitrile |
| SMILES | C=C/C=C(\C=C(/C)C#N)CC |
| InChI | InChI=1S/C10H13N/c1-4-6-10(5-2)7-9(3)8-11/h4,6-7H,1,5H2,2-3H3/b9-7+,10-6- |
| InChIKey | RYJHWHNQQNDDMQ-BVCWLXBRSA-N |
| XLogP | 2.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|