C13H28 — CID 143457916
ethane;(3Z)-3-ethylhexa-1,3,5-triene;methane (PubChem CID 143457916) has the molecular formula C13H28 and a molecular weight of 184.37 g/mol. Its IUPAC name is ethane;(3Z)-3-ethylhexa-1,3,5-triene;methane.
| Compound Name | ethane;(3Z)-3-ethylhexa-1,3,5-triene;methane |
|---|---|
| PubChem CID | 143457916 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | ethane;(3Z)-3-ethylhexa-1,3,5-triene;methane |
| SMILES | C.C=C/C=C(\C=C)CC.CC.CC |
| InChI | InChI=1S/C8H12.2C2H6.CH4/c1-4-7-8(5-2)6-3;2*1-2;/h4-5,7H,1-2,6H2,3H3;2*1-2H3;1H4/b8-7+;;; |
| InChIKey | PZEDWHLNJHJIPB-SYVONOGFSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|