C11H16 — CID 143912648
(3E,5E,7E)-4-ethylnona-1,3,5,7-tetraene (PubChem CID 143912648) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is (3E,5E,7E)-4-ethylnona-1,3,5,7-tetraene.
| Compound Name | (3E,5E,7E)-4-ethylnona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 143912648 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (3E,5E,7E)-4-ethylnona-1,3,5,7-tetraene |
| SMILES | C=C/C=C(/C=C/C=C/C)CC |
| InChI | InChI=1S/C11H16/c1-4-7-8-10-11(6-3)9-5-2/h4-5,7-10H,2,6H2,1,3H3/b7-4+,10-8+,11-9+ |
| InChIKey | XKLFFKVZZQCHEJ-WRHDDKGYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|