C17H22 — CID 145151868
(3E,5E,6Z,8E)-5-[(Z)-but-2-enylidene]-4-[(Z)-prop-1-enyl]deca-1,3,6,8-tetraene (PubChem CID 145151868) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is (3E,5E,6Z,8E)-5-[(Z)-but-2-enylidene]-4-[(Z)-prop-1-enyl]deca-1,3,6,8-tetraene.
| Compound Name | (3E,5E,6Z,8E)-5-[(Z)-but-2-enylidene]-4-[(Z)-prop-1-enyl]deca-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 145151868 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (3E,5E,6Z,8E)-5-[(Z)-but-2-enylidene]-4-[(Z)-prop-1-enyl]deca-1,3,6,8-tetraene |
| SMILES | C=C/C=C(\C=C/C)C(/C=C\C=C\C)=C/C=C\C |
| InChI | InChI=1S/C17H22/c1-5-9-11-15-17(14-10-6-2)16(12-7-3)13-8-4/h5-15H,3H2,1-2,4H3/b9-5+,10-6-,13-8-,15-11-,16-12+,17-14+ |
| InChIKey | PRWNFIAPAYGKPV-PVDGRMGLSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|