C14H18O — CID 130346277
(3E,6E,8Z)-4-methyl-6-[(Z)-prop-1-enyl]deca-1,3,6,8-tetraen-5-one (PubChem CID 130346277) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (3E,6E,8Z)-4-methyl-6-[(Z)-prop-1-enyl]deca-1,3,6,8-tetraen-5-one.
| Compound Name | (3E,6E,8Z)-4-methyl-6-[(Z)-prop-1-enyl]deca-1,3,6,8-tetraen-5-one |
|---|---|
| PubChem CID | 130346277 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (3E,6E,8Z)-4-methyl-6-[(Z)-prop-1-enyl]deca-1,3,6,8-tetraen-5-one |
| SMILES | C=C/C=C(\C)C(=O)C(/C=C\C)=C/C=C\C |
| InChI | InChI=1S/C14H18O/c1-5-8-11-13(10-7-3)14(15)12(4)9-6-2/h5-11H,2H2,1,3-4H3/b8-5-,10-7-,12-9+,13-11+ |
| InChIKey | XAIYCRFZLYYASR-SZXPQPFKSA-N |
| XLogP | 3.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|