C11H15NO2 — CID 144531341
N-acetyl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]acetamide (PubChem CID 144531341) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-acetyl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]acetamide.
| Compound Name | N-acetyl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]acetamide |
|---|---|
| PubChem CID | 144531341 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-acetyl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]acetamide |
| SMILES | C=C/C=C(\C=C/C)N(C(C)=O)C(C)=O |
| InChI | InChI=1S/C11H15NO2/c1-5-7-11(8-6-2)12(9(3)13)10(4)14/h5-8H,1H2,2-4H3/b8-6-,11-7+ |
| InChIKey | ZQCNDQOQQBAWAB-FAWHLJIPSA-N |
| XLogP | 2.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|