C12H21N — CID 143005008
(3E,5Z)-N-butyl-N-methylhepta-1,3,5-trien-4-amine (PubChem CID 143005008) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (3E,5Z)-N-butyl-N-methylhepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-N-butyl-N-methylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 143005008 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (3E,5Z)-N-butyl-N-methylhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(\C=C/C)N(C)CCCC |
| InChI | InChI=1S/C12H21N/c1-5-8-11-13(4)12(9-6-2)10-7-3/h6-7,9-10H,2,5,8,11H2,1,3-4H3/b10-7-,12-9+ |
| InChIKey | MBUQYOLGZJGAEV-PWZCAXEFSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|