C13H28N2 — CID 143115290
ethane;N'-[(2E,4Z)-hexa-2,4-dien-3-yl]-N,N'-dimethylpropane-1,3-diamine (PubChem CID 143115290) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is ethane;N'-[(2E,4Z)-hexa-2,4-dien-3-yl]-N,N'-dimethylpropane-1,3-diamine.
| Compound Name | ethane;N'-[(2E,4Z)-hexa-2,4-dien-3-yl]-N,N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 143115290 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | ethane;N'-[(2E,4Z)-hexa-2,4-dien-3-yl]-N,N'-dimethylpropane-1,3-diamine |
| SMILES | C/C=C\C(=C/C)N(C)CCCNC.CC |
| InChI | InChI=1S/C11H22N2.C2H6/c1-5-8-11(6-2)13(4)10-7-9-12-3;1-2/h5-6,8,12H,7,9-10H2,1-4H3;1-2H3/b8-5-,11-6+; |
| InChIKey | ADWOEGKDRTWSEM-GDRGGGTESA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|