C7H14F2N2O — CID 103514245
2,2-difluoro-N-methyl-N-[3-(methylamino)propyl]acetamide (PubChem CID 103514245) has the molecular formula C7H14F2N2O and a molecular weight of 180.20 g/mol. Its IUPAC name is 2,2-difluoro-N-methyl-N-[3-(methylamino)propyl]acetamide.
| Compound Name | 2,2-difluoro-N-methyl-N-[3-(methylamino)propyl]acetamide |
|---|---|
| PubChem CID | 103514245 |
| Molecular Formula | C7H14F2N2O |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 2,2-difluoro-N-methyl-N-[3-(methylamino)propyl]acetamide |
| SMILES | CNCCCN(C)C(=O)C(F)F |
| InChI | InChI=1S/C7H14F2N2O/c1-10-4-3-5-11(2)7(12)6(8)9/h6,10H,3-5H2,1-2H3 |
| InChIKey | HIUFFFPHIMYKIT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|