C4H8F2N2O — CID 12596295
2,2-difluoro-N,N'-dimethylacetohydrazide (PubChem CID 12596295) has the molecular formula C4H8F2N2O and a molecular weight of 138.12 g/mol. Its IUPAC name is 2,2-difluoro-N,N'-dimethylacetohydrazide.
| Compound Name | 2,2-difluoro-N,N'-dimethylacetohydrazide |
|---|---|
| PubChem CID | 12596295 |
| Molecular Formula | C4H8F2N2O |
| Molecular Weight | 138.12 g/mol |
| Exact Mass | 138.06 |
| IUPAC Name | 2,2-difluoro-N,N'-dimethylacetohydrazide |
| SMILES | CNN(C)C(=O)C(F)F |
| InChI | InChI=1S/C4H8F2N2O/c1-7-8(2)4(9)3(5)6/h3,7H,1-2H3 |
| InChIKey | SWTNQOGTTAKWHN-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.12 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|