C7H14FNO — CID 130964649
2-fluoro-N,N,3-trimethylbutanamide (PubChem CID 130964649) has the molecular formula C7H14FNO and a molecular weight of 147.19 g/mol. Its IUPAC name is 2-fluoro-N,N,3-trimethylbutanamide.
| Compound Name | 2-fluoro-N,N,3-trimethylbutanamide |
|---|---|
| PubChem CID | 130964649 |
| Molecular Formula | C7H14FNO |
| Molecular Weight | 147.19 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | 2-fluoro-N,N,3-trimethylbutanamide |
| SMILES | CC(C)C(F)C(=O)N(C)C |
| InChI | InChI=1S/C7H14FNO/c1-5(2)6(8)7(10)9(3)4/h5-6H,1-4H3 |
| InChIKey | SSUACVWIWBGVNZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |