C8H20N2O4S2 — CID 74892775
2,3-dihydroxy-N,N,N',N'-tetramethylbutanediamide;sulfane (PubChem CID 74892775) has the molecular formula C8H20N2O4S2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2,3-dihydroxy-N,N,N',N'-tetramethylbutanediamide;sulfane.
| Compound Name | 2,3-dihydroxy-N,N,N',N'-tetramethylbutanediamide;sulfane |
|---|---|
| PubChem CID | 74892775 |
| Molecular Formula | C8H20N2O4S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2,3-dihydroxy-N,N,N',N'-tetramethylbutanediamide;sulfane |
| SMILES | CN(C)C(=O)C(O)C(O)C(=O)N(C)C.S.S |
| InChI | InChI=1S/C8H16N2O4.2H2S/c1-9(2)7(13)5(11)6(12)8(14)10(3)4;;/h5-6,11-12H,1-4H3;2*1H2 |
| InChIKey | MVEZOCVGAOWVEB-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |