C15H22N2O4 — CID 561543
2-hydroxy-N,N,N',N'-tetramethyl-3-phenylmethoxybutanediamide (PubChem CID 561543) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-hydroxy-N,N,N',N'-tetramethyl-3-phenylmethoxybutanediamide.
| Compound Name | 2-hydroxy-N,N,N',N'-tetramethyl-3-phenylmethoxybutanediamide |
|---|---|
| PubChem CID | 561543 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-hydroxy-N,N,N',N'-tetramethyl-3-phenylmethoxybutanediamide |
| SMILES | CN(C)C(=O)C(O)C(OCc1ccccc1)C(=O)N(C)C |
| InChI | InChI=1S/C15H22N2O4/c1-16(2)14(19)12(18)13(15(20)17(3)4)21-10-11-8-6-5-7-9-11/h5-9,12-13,18H,10H2,1-4H3 |
| InChIKey | QNLMRDTUNBDLRL-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |