C11H15NO2 — CID 18771503
2-hydroxy-N,N-dimethyl-3-phenylpropanamide (PubChem CID 18771503) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-3-phenylpropanamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 18771503 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-3-phenylpropanamide |
| SMILES | CN(C)C(=O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c1-12(2)11(14)10(13)8-9-6-4-3-5-7-9/h3-7,10,13H,8H2,1-2H3 |
| InChIKey | LOQLTMLSQNYSKO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |