C16H24O4 — CID 174968865
2-hydroxy-4-methyl-1-phenylpentan-3-one;2-methylpropanoic acid (PubChem CID 174968865) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-1-phenylpentan-3-one;2-methylpropanoic acid.
| Compound Name | 2-hydroxy-4-methyl-1-phenylpentan-3-one;2-methylpropanoic acid |
|---|---|
| PubChem CID | 174968865 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-hydroxy-4-methyl-1-phenylpentan-3-one;2-methylpropanoic acid |
| SMILES | CC(C)C(=O)C(O)Cc1ccccc1.CC(C)C(=O)O |
| InChI | InChI=1S/C12H16O2.C4H8O2/c1-9(2)12(14)11(13)8-10-6-4-3-5-7-10;1-3(2)4(5)6/h3-7,9,11,13H,8H2,1-2H3;3H,1-2H3,(H,5,6) |
| InChIKey | PFMGBNAAZVGVHE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |