C8H15NO2 — CID 11205913
N,N,2-trimethyl-3-oxopentanamide (PubChem CID 11205913) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is N,N,2-trimethyl-3-oxopentanamide.
| Compound Name | N,N,2-trimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 11205913 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | N,N,2-trimethyl-3-oxopentanamide |
| SMILES | CCC(=O)C(C)C(=O)N(C)C |
| InChI | InChI=1S/C8H15NO2/c1-5-7(10)6(2)8(11)9(3)4/h6H,5H2,1-4H3 |
| InChIKey | QMZAQINHGRTFAB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|