C6H12BrNO — CID 92939009
(2S)-2-bromo-N,N-dimethylbutanamide (PubChem CID 92939009) has the molecular formula C6H12BrNO and a molecular weight of 194.07 g/mol. Its IUPAC name is (2S)-2-bromo-N,N-dimethylbutanamide.
| Compound Name | (2S)-2-bromo-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 92939009 |
| Molecular Formula | C6H12BrNO |
| Molecular Weight | 194.07 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | (2S)-2-bromo-N,N-dimethylbutanamide |
| SMILES | CC[C@H](Br)C(=O)N(C)C |
| InChI | InChI=1S/C6H12BrNO/c1-4-5(7)6(9)8(2)3/h5H,4H2,1-3H3/t5-/m0/s1 |
| InChIKey | NNWWOIPEHSLORU-YFKPBYRVSA-N |
| XLogP | 1.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.07 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|