C6H14N2O — CID 43649466
2-amino-N,N-dimethylbutanamide (PubChem CID 43649466) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is 2-amino-N,N-dimethylbutanamide.
| Compound Name | 2-amino-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 43649466 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | 2-amino-N,N-dimethylbutanamide |
| SMILES | CCC(N)C(=O)N(C)C |
| InChI | InChI=1S/C6H14N2O/c1-4-5(7)6(9)8(2)3/h5H,4,7H2,1-3H3 |
| InChIKey | WRVUTVMOKGGDME-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |