C6H14N2O2 — CID 89160145
(2R)-2-amino-4-hydroxy-N,N-dimethylbutanamide (PubChem CID 89160145) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is (2R)-2-amino-4-hydroxy-N,N-dimethylbutanamide.
| Compound Name | (2R)-2-amino-4-hydroxy-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 89160145 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (2R)-2-amino-4-hydroxy-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)[C@H](N)CCO |
| InChI | InChI=1S/C6H14N2O2/c1-8(2)6(10)5(7)3-4-9/h5,9H,3-4,7H2,1-2H3/t5-/m1/s1 |
| InChIKey | JEPZCPUPTHYUEY-RXMQYKEDSA-N |
| XLogP | -1.22 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |