C9H19NO4 — CID 89464995
5-hydroxy-2,3-dimethoxy-N,N-dimethylpentanamide (PubChem CID 89464995) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is 5-hydroxy-2,3-dimethoxy-N,N-dimethylpentanamide.
| Compound Name | 5-hydroxy-2,3-dimethoxy-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 89464995 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 5-hydroxy-2,3-dimethoxy-N,N-dimethylpentanamide |
| SMILES | COC(CCO)C(OC)C(=O)N(C)C |
| InChI | InChI=1S/C9H19NO4/c1-10(2)9(12)8(14-4)7(13-3)5-6-11/h7-8,11H,5-6H2,1-4H3 |
| InChIKey | VBKADDASVLIQIL-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |