C10H21NO — CID 3019000
2-ethyl-N,N-dimethylhexanamide (PubChem CID 3019000) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is 2-ethyl-N,N-dimethylhexanamide.
| Compound Name | 2-ethyl-N,N-dimethylhexanamide |
|---|---|
| PubChem CID | 3019000 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 2-ethyl-N,N-dimethylhexanamide |
| SMILES | CCCCC(CC)C(=O)N(C)C |
| InChI | InChI=1S/C10H21NO/c1-5-7-8-9(6-2)10(12)11(3)4/h9H,5-8H2,1-4H3 |
| InChIKey | YVAKVTNKLMUNBR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |