C11H23NO2 — CID 23126581
2-(2-hydroxypropan-2-yl)-N,N-dimethylhexanamide (PubChem CID 23126581) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-(2-hydroxypropan-2-yl)-N,N-dimethylhexanamide.
| Compound Name | 2-(2-hydroxypropan-2-yl)-N,N-dimethylhexanamide |
|---|---|
| PubChem CID | 23126581 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 2-(2-hydroxypropan-2-yl)-N,N-dimethylhexanamide |
| SMILES | CCCCC(C(=O)N(C)C)C(C)(C)O |
| InChI | InChI=1S/C11H23NO2/c1-6-7-8-9(11(2,3)14)10(13)12(4)5/h9,14H,6-8H2,1-5H3 |
| InChIKey | GLQNANFXSAVAAU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |