C13H25F3N3O2- — CID 165053839
1,1,3,3-tetramethylguanidine;2-(2,2,2-trifluoroethyl)hexanoate (PubChem CID 165053839) has the molecular formula C13H25F3N3O2- and a molecular weight of 312.36 g/mol. Its IUPAC name is 1,1,3,3-tetramethylguanidine;2-(2,2,2-trifluoroethyl)hexanoate.
| Compound Name | 1,1,3,3-tetramethylguanidine;2-(2,2,2-trifluoroethyl)hexanoate |
|---|---|
| PubChem CID | 165053839 |
| Molecular Formula | C13H25F3N3O2- |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1,1,3,3-tetramethylguanidine;2-(2,2,2-trifluoroethyl)hexanoate |
| SMILES | CCCCC(CC(F)(F)F)C(=O)[O-].[H]N=C(N(C)C)N(C)C |
| InChI | InChI=1S/C8H13F3O2.C5H13N3/c1-2-3-4-6(7(12)13)5-8(9,10)11;1-7(2)5(6)8(3)4/h6H,2-5H2,1H3,(H,12,13);6H,1-4H3/p-1 |
| InChIKey | QBWCCEXOWKEOKR-UHFFFAOYSA-M |
| XLogP | 1.54 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|