C23H42N2O6 — CID 57004896
diethyl 2,2-bis[1-(dimethylamino)-1-oxohexan-2-yl]propanedioate (PubChem CID 57004896) has the molecular formula C23H42N2O6 and a molecular weight of 442.60 g/mol. Its IUPAC name is diethyl 2,2-bis[1-(dimethylamino)-1-oxohexan-2-yl]propanedioate.
| Compound Name | diethyl 2,2-bis[1-(dimethylamino)-1-oxohexan-2-yl]propanedioate |
|---|---|
| PubChem CID | 57004896 |
| Molecular Formula | C23H42N2O6 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | diethyl 2,2-bis[1-(dimethylamino)-1-oxohexan-2-yl]propanedioate |
| SMILES | CCCCC(C(=O)N(C)C)C(C(=O)OCC)(C(=O)OCC)C(CCCC)C(=O)N(C)C |
| InChI | InChI=1S/C23H42N2O6/c1-9-13-15-17(19(26)24(5)6)23(21(28)30-11-3,22(29)31-12-4)18(16-14-10-2)20(27)25(7)8/h17-18H,9-16H2,1-8H3 |
| InChIKey | IYXWRHWWADTBIM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|