About ethyl 2,2,4-trichlorooctanoate
ethyl 2,2,4-trichlorooctanoate (PubChem CID 14970938) has the molecular formula C10H17Cl3O2
and a molecular weight of 275.60 g/mol. Its IUPAC name is ethyl 2,2,4-trichlorooctanoate.
Molecular Properties
| Compound Name | ethyl 2,2,4-trichlorooctanoate |
| PubChem CID | 14970938 |
| Molecular Formula | C10H17Cl3O2 |
| Molecular Weight | 275.60 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | ethyl 2,2,4-trichlorooctanoate |
| SMILES | CCCCC(Cl)CC(Cl)(Cl)C(=O)OCC |
| InChI | InChI=1S/C10H17Cl3O2/c1-3-5-6-8(11)7-10(12,13)9(14)15-4-2/h8H,3-7H2,1-2H3 |
| InChIKey | DGXCDSFBOQVBGX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2,2,4-trichlorooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,2,4-trichlorooctanoate?
The IUPAC name of ethyl 2,2,4-trichlorooctanoate (CID 14970938) is ethyl 2,2,4-trichlorooctanoate.
What is the SMILES notation for ethyl 2,2,4-trichlorooctanoate?
The canonical SMILES for ethyl 2,2,4-trichlorooctanoate is CCCCC(Cl)CC(Cl)(Cl)C(=O)OCC.
What is the InChIKey of ethyl 2,2,4-trichlorooctanoate?
The InChIKey is DGXCDSFBOQVBGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17Cl3O2/c1-3-5-6-8(11)7-10(12,13)9(14)15-4-2/h8H,3-7H2,1-2H3.
What are the key properties of ethyl 2,2,4-trichlorooctanoate?
ethyl 2,2,4-trichlorooctanoate has a molecular weight of 275.60 g/mol, XLogP of 3.91, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2,4-trichlorooctanoate is sourced from PubChem (CID 14970938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).