C14H20Cl2O8S2 — CID 10837297
diethyl 2-chloro-2-[(2-chloro-1,3-diethoxy-1,3-dioxopropan-2-yl)disulfanyl]propanedioate (PubChem CID 10837297) has the molecular formula C14H20Cl2O8S2 and a molecular weight of 451.35 g/mol. Its IUPAC name is diethyl 2-chloro-2-[(2-chloro-1,3-diethoxy-1,3-dioxopropan-2-yl)disulfanyl]propanedioate.
| Compound Name | diethyl 2-chloro-2-[(2-chloro-1,3-diethoxy-1,3-dioxopropan-2-yl)disulfanyl]propanedioate |
|---|---|
| PubChem CID | 10837297 |
| Molecular Formula | C14H20Cl2O8S2 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | diethyl 2-chloro-2-[(2-chloro-1,3-diethoxy-1,3-dioxopropan-2-yl)disulfanyl]propanedioate |
| SMILES | CCOC(=O)C(Cl)(SSC(Cl)(C(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C14H20Cl2O8S2/c1-5-21-9(17)13(15,10(18)22-6-2)25-26-14(16,11(19)23-7-3)12(20)24-8-4/h5-8H2,1-4H3 |
| InChIKey | JQQHJBOAAMRPCS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|