C9H16Cl2O4 — CID 14926947
ethyl 2,2-dichloro-3,3-diethoxypropanoate (PubChem CID 14926947) has the molecular formula C9H16Cl2O4 and a molecular weight of 259.13 g/mol. Its IUPAC name is ethyl 2,2-dichloro-3,3-diethoxypropanoate.
| Compound Name | ethyl 2,2-dichloro-3,3-diethoxypropanoate |
|---|---|
| PubChem CID | 14926947 |
| Molecular Formula | C9H16Cl2O4 |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | ethyl 2,2-dichloro-3,3-diethoxypropanoate |
| SMILES | CCOC(=O)C(Cl)(Cl)C(OCC)OCC |
| InChI | InChI=1S/C9H16Cl2O4/c1-4-13-7(12)9(10,11)8(14-5-2)15-6-3/h8H,4-6H2,1-3H3 |
| InChIKey | STORYPXBTAVHLJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|