C9H10Cl2F4O4S2 — CID 12639396
diethyl 2,2-bis[[chloro(difluoro)methyl]sulfanyl]propanedioate (PubChem CID 12639396) has the molecular formula C9H10Cl2F4O4S2 and a molecular weight of 393.21 g/mol. Its IUPAC name is diethyl 2,2-bis[[chloro(difluoro)methyl]sulfanyl]propanedioate.
| Compound Name | diethyl 2,2-bis[[chloro(difluoro)methyl]sulfanyl]propanedioate |
|---|---|
| PubChem CID | 12639396 |
| Molecular Formula | C9H10Cl2F4O4S2 |
| Molecular Weight | 393.21 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | diethyl 2,2-bis[[chloro(difluoro)methyl]sulfanyl]propanedioate |
| SMILES | CCOC(=O)C(SC(F)(F)Cl)(SC(F)(F)Cl)C(=O)OCC |
| InChI | InChI=1S/C9H10Cl2F4O4S2/c1-3-18-5(16)7(6(17)19-4-2,20-8(10,12)13)21-9(11,14)15/h3-4H2,1-2H3 |
| InChIKey | SFNJBOGOZMHWHG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.21 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|