C8H11ClF3NO4 — CID 2781158
ethyl 2-chloro-2-(ethoxycarbonylamino)-3,3,3-trifluoropropanoate (PubChem CID 2781158) has the molecular formula C8H11ClF3NO4 and a molecular weight of 277.63 g/mol. Its IUPAC name is ethyl 2-chloro-2-(ethoxycarbonylamino)-3,3,3-trifluoropropanoate.
| Compound Name | ethyl 2-chloro-2-(ethoxycarbonylamino)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 2781158 |
| Molecular Formula | C8H11ClF3NO4 |
| Molecular Weight | 277.63 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | ethyl 2-chloro-2-(ethoxycarbonylamino)-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)NC(Cl)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C8H11ClF3NO4/c1-3-16-5(14)7(9,8(10,11)12)13-6(15)17-4-2/h3-4H2,1-2H3,(H,13,15) |
| InChIKey | UNCYZOKHAJMECA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.63 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|