C10H15ClF3NO3 — CID 546073
ethyl 2-chloro-3,3,3-trifluoro-2-(3-methylbutanoylamino)propanoate (PubChem CID 546073) has the molecular formula C10H15ClF3NO3 and a molecular weight of 289.68 g/mol. Its IUPAC name is ethyl 2-chloro-3,3,3-trifluoro-2-(3-methylbutanoylamino)propanoate.
| Compound Name | ethyl 2-chloro-3,3,3-trifluoro-2-(3-methylbutanoylamino)propanoate |
|---|---|
| PubChem CID | 546073 |
| Molecular Formula | C10H15ClF3NO3 |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | ethyl 2-chloro-3,3,3-trifluoro-2-(3-methylbutanoylamino)propanoate |
| SMILES | CCOC(=O)C(Cl)(NC(=O)CC(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H15ClF3NO3/c1-4-18-8(17)9(11,10(12,13)14)15-7(16)5-6(2)3/h6H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | WGFXJICLYYWBJV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|