C13H24F3N2O3+ — CID 7129702
[(2R)-2-(butanoylamino)-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]-(2-methylpropyl)azanium (PubChem CID 7129702) has the molecular formula C13H24F3N2O3+ and a molecular weight of 313.34 g/mol. Its IUPAC name is [(2R)-2-(butanoylamino)-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]-(2-methylpropyl)azanium.
| Compound Name | [(2R)-2-(butanoylamino)-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]-(2-methylpropyl)azanium |
|---|---|
| PubChem CID | 7129702 |
| Molecular Formula | C13H24F3N2O3+ |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | [(2R)-2-(butanoylamino)-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]-(2-methylpropyl)azanium |
| SMILES | CCCC(=O)N[C@@]([NH2+]CC(C)C)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C13H23F3N2O3/c1-5-7-10(19)18-12(13(14,15)16,11(20)21-6-2)17-8-9(3)4/h9,17H,5-8H2,1-4H3,(H,18,19)/p+1/t12-/m0/s1 |
| InChIKey | PHAJQRKQNHZYHW-LBPRGKRZSA-O |
| XLogP | 0.94 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|