C11H18F3NO4 — CID 40526838
ethyl (2S)-2-acetamido-3,3,3-trifluoro-2-(2-methylpropoxy)propanoate (PubChem CID 40526838) has the molecular formula C11H18F3NO4 and a molecular weight of 285.26 g/mol. Its IUPAC name is ethyl (2S)-2-acetamido-3,3,3-trifluoro-2-(2-methylpropoxy)propanoate.
| Compound Name | ethyl (2S)-2-acetamido-3,3,3-trifluoro-2-(2-methylpropoxy)propanoate |
|---|---|
| PubChem CID | 40526838 |
| Molecular Formula | C11H18F3NO4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | ethyl (2S)-2-acetamido-3,3,3-trifluoro-2-(2-methylpropoxy)propanoate |
| SMILES | CCOC(=O)[C@](NC(C)=O)(OCC(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H18F3NO4/c1-5-18-9(17)10(11(12,13)14,15-8(4)16)19-6-7(2)3/h7H,5-6H2,1-4H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | TUPXOJSCTRSUPP-JTQLQIEISA-N |
| XLogP | 1.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|