C7H10F3NO4 — CID 7037438
ethyl (2R)-2-acetamido-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 7037438) has the molecular formula C7H10F3NO4 and a molecular weight of 229.15 g/mol. Its IUPAC name is ethyl (2R)-2-acetamido-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | ethyl (2R)-2-acetamido-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 7037438 |
| Molecular Formula | C7H10F3NO4 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | ethyl (2R)-2-acetamido-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@](O)(NC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C7H10F3NO4/c1-3-15-5(13)6(14,7(8,9)10)11-4(2)12/h14H,3H2,1-2H3,(H,11,12)/t6-/m1/s1 |
| InChIKey | FMTMLHIXLZJNTA-ZCFIWIBFSA-N |
| XLogP | -0.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|