C10H17F3N2O4 — CID 3816115
ethyl 2-acetamido-3,3,3-trifluoro-2-(2-methoxyethylamino)propanoate (PubChem CID 3816115) has the molecular formula C10H17F3N2O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is ethyl 2-acetamido-3,3,3-trifluoro-2-(2-methoxyethylamino)propanoate.
| Compound Name | ethyl 2-acetamido-3,3,3-trifluoro-2-(2-methoxyethylamino)propanoate |
|---|---|
| PubChem CID | 3816115 |
| Molecular Formula | C10H17F3N2O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | ethyl 2-acetamido-3,3,3-trifluoro-2-(2-methoxyethylamino)propanoate |
| SMILES | CCOC(=O)C(NCCOC)(NC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O4/c1-4-19-8(17)9(10(11,12)13,15-7(2)16)14-5-6-18-3/h14H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | VVRDOEMRNPNCKJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|